C21H17N3O4 — CID 4591077
ethyl 4-[5-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)iminomethyl]furan-2-yl]benzoate (PubChem CID 4591077) has the molecular formula C21H17N3O4 and a molecular weight of 375.38 g/mol. Its IUPAC name is ethyl 4-[5-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)iminomethyl]furan-2-yl]benzoate.
| Compound Name | ethyl 4-[5-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)iminomethyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 4591077 |
| Molecular Formula | C21H17N3O4 |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | ethyl 4-[5-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)iminomethyl]furan-2-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(-c2ccc(/C=N/c3ccc4[nH]c(=O)[nH]c4c3)o2)cc1 |
| InChI | InChI=1S/C21H17N3O4/c1-2-27-20(25)14-5-3-13(4-6-14)19-10-8-16(28-19)12-22-15-7-9-17-18(11-15)24-21(26)23-17/h3-12H,2H2,1H3,(H2,23,24,26)/b22-12+ |
| InChIKey | TUPJYUPVLWWPJH-WSDLNYQXSA-N |
| XLogP | 4.04 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|