C17H16Br2N2O3 — CID 4597469
N'-[2,2-bis(4-bromophenyl)-2-hydroxyacetyl]propanehydrazide (PubChem CID 4597469) has the molecular formula C17H16Br2N2O3 and a molecular weight of 456.13 g/mol. Its IUPAC name is N'-[2,2-bis(4-bromophenyl)-2-hydroxyacetyl]propanehydrazide.
| Compound Name | N'-[2,2-bis(4-bromophenyl)-2-hydroxyacetyl]propanehydrazide |
|---|---|
| PubChem CID | 4597469 |
| Molecular Formula | C17H16Br2N2O3 |
| Molecular Weight | 456.13 g/mol |
| Exact Mass | 453.95 |
| IUPAC Name | N'-[2,2-bis(4-bromophenyl)-2-hydroxyacetyl]propanehydrazide |
| SMILES | CCC(=O)NNC(=O)C(O)(c1ccc(Br)cc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C17H16Br2N2O3/c1-2-15(22)20-21-16(23)17(24,11-3-7-13(18)8-4-11)12-5-9-14(19)10-6-12/h3-10,24H,2H2,1H3,(H,20,22)(H,21,23) |
| InChIKey | NSMLJCOVWXFQJX-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.13 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|