C17H17FN4O4 — CID 46047195
ethyl 2-[1-ethyl-3-(4-fluorophenyl)-2,6-dioxopurin-7-yl]acetate (PubChem CID 46047195) has the molecular formula C17H17FN4O4 and a molecular weight of 360.35 g/mol. Its IUPAC name is ethyl 2-[1-ethyl-3-(4-fluorophenyl)-2,6-dioxopurin-7-yl]acetate.
| Compound Name | ethyl 2-[1-ethyl-3-(4-fluorophenyl)-2,6-dioxopurin-7-yl]acetate |
|---|---|
| PubChem CID | 46047195 |
| Molecular Formula | C17H17FN4O4 |
| Molecular Weight | 360.35 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | ethyl 2-[1-ethyl-3-(4-fluorophenyl)-2,6-dioxopurin-7-yl]acetate |
| SMILES | CCOC(=O)Cn1cnc2c1c(=O)n(CC)c(=O)n2-c1ccc(F)cc1 |
| InChI | InChI=1S/C17H17FN4O4/c1-3-21-16(24)14-15(19-10-20(14)9-13(23)26-4-2)22(17(21)25)12-7-5-11(18)6-8-12/h5-8,10H,3-4,9H2,1-2H3 |
| InChIKey | ZRXAYFQFXAACPT-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 88.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.35 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |