C20H19ClF6N3O+ — CID 4605251
2-chloro-N-[1,1,1,3,3,3-hexafluoro-2-(2-pyridin-3-ylpiperidin-1-ium-1-yl)propan-2-yl]benzamide (PubChem CID 4605251) has the molecular formula C20H19ClF6N3O+ and a molecular weight of 466.83 g/mol. Its IUPAC name is 2-chloro-N-[1,1,1,3,3,3-hexafluoro-2-(2-pyridin-3-ylpiperidin-1-ium-1-yl)propan-2-yl]benzamide.
| Compound Name | 2-chloro-N-[1,1,1,3,3,3-hexafluoro-2-(2-pyridin-3-ylpiperidin-1-ium-1-yl)propan-2-yl]benzamide |
|---|---|
| PubChem CID | 4605251 |
| Molecular Formula | C20H19ClF6N3O+ |
| Molecular Weight | 466.83 g/mol |
| Exact Mass | 466.11 |
| IUPAC Name | 2-chloro-N-[1,1,1,3,3,3-hexafluoro-2-(2-pyridin-3-ylpiperidin-1-ium-1-yl)propan-2-yl]benzamide |
| SMILES | O=C(NC([NH+]1CCCCC1c1cccnc1)(C(F)(F)F)C(F)(F)F)c1ccccc1Cl |
| InChI | InChI=1S/C20H18ClF6N3O/c21-15-8-2-1-7-14(15)17(31)29-18(19(22,23)24,20(25,26)27)30-11-4-3-9-16(30)13-6-5-10-28-12-13/h1-2,5-8,10,12,16H,3-4,9,11H2,(H,29,31)/p+1 |
| InChIKey | XKDMDKUZJRMUPB-UHFFFAOYSA-O |
| XLogP | 4.10 |
| TPSA | 46.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.83 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |