C10H16IN3 — CID 149457997
N-methyl-2-pyridin-3-ylpyrrolidin-1-ium-1-amine iodide (PubChem CID 149457997) has the molecular formula C10H16IN3 and a molecular weight of 305.16 g/mol. Its IUPAC name is N-methyl-2-pyridin-3-ylpyrrolidin-1-ium-1-amine iodide.
| Compound Name | N-methyl-2-pyridin-3-ylpyrrolidin-1-ium-1-amine iodide |
|---|---|
| PubChem CID | 149457997 |
| Molecular Formula | C10H16IN3 |
| Molecular Weight | 305.16 g/mol |
| Exact Mass | 305.04 |
| IUPAC Name | N-methyl-2-pyridin-3-ylpyrrolidin-1-ium-1-amine iodide |
| SMILES | CN[NH+]1CCCC1c1cccnc1.[I-] |
| InChI | InChI=1S/C10H15N3.HI/c1-11-13-7-3-5-10(13)9-4-2-6-12-8-9;/h2,4,6,8,10-11H,3,5,7H2,1H3;1H |
| InChIKey | RMSYWXVTRGMQCP-UHFFFAOYSA-N |
| XLogP | -3.06 |
| TPSA | 29.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.16 |
| LogP ≤ 5 | -3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|