C18H25F4NO4 — CID 46059444
1-[2-[(2-methylphenoxy)methyl]morpholin-4-yl]-3-(2,2,3,3-tetrafluoropropoxy)propan-2-ol (PubChem CID 46059444) has the molecular formula C18H25F4NO4 and a molecular weight of 395.39 g/mol. Its IUPAC name is 1-[2-[(2-methylphenoxy)methyl]morpholin-4-yl]-3-(2,2,3,3-tetrafluoropropoxy)propan-2-ol.
| Compound Name | 1-[2-[(2-methylphenoxy)methyl]morpholin-4-yl]-3-(2,2,3,3-tetrafluoropropoxy)propan-2-ol |
|---|---|
| PubChem CID | 46059444 |
| Molecular Formula | C18H25F4NO4 |
| Molecular Weight | 395.39 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | 1-[2-[(2-methylphenoxy)methyl]morpholin-4-yl]-3-(2,2,3,3-tetrafluoropropoxy)propan-2-ol |
| SMILES | Cc1ccccc1OCC1CN(CC(O)COCC(F)(F)C(F)F)CCO1 |
| InChI | InChI=1S/C18H25F4NO4/c1-13-4-2-3-5-16(13)27-11-15-9-23(6-7-26-15)8-14(24)10-25-12-18(21,22)17(19)20/h2-5,14-15,17,24H,6-12H2,1H3 |
| InChIKey | BTZPSIVSSPJDSB-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.39 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|