C25H22BrF3N4O2 — CID 46081429
(4-bromo-1-ethyl-3-methylpyrazol-5-yl)-[6-methoxy-1-(2,4,5-trifluorophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methanone (PubChem CID 46081429) has the molecular formula C25H22BrF3N4O2 and a molecular weight of 547.38 g/mol. Its IUPAC name is (4-bromo-1-ethyl-3-methylpyrazol-5-yl)-[6-methoxy-1-(2,4,5-trifluorophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methanone.
| Compound Name | (4-bromo-1-ethyl-3-methylpyrazol-5-yl)-[6-methoxy-1-(2,4,5-trifluorophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methanone |
|---|---|
| PubChem CID | 46081429 |
| Molecular Formula | C25H22BrF3N4O2 |
| Molecular Weight | 547.38 g/mol |
| Exact Mass | 546.09 |
| IUPAC Name | (4-bromo-1-ethyl-3-methylpyrazol-5-yl)-[6-methoxy-1-(2,4,5-trifluorophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methanone |
| SMILES | CCn1nc(C)c(Br)c1C(=O)N1CCc2c([nH]c3ccc(OC)cc23)C1c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C25H22BrF3N4O2/c1-4-33-24(21(26)12(2)31-33)25(34)32-8-7-14-15-9-13(35-3)5-6-20(15)30-22(14)23(32)16-10-18(28)19(29)11-17(16)27/h5-6,9-11,23,30H,4,7-8H2,1-3H3 |
| InChIKey | MXFBSYOYXYACQE-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 63.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.38 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|