C23H22F3N3O3S2 — CID 46097905
N,N-diethyl-1-(furan-2-ylmethyl)-2-[(2,4,5-trifluorophenyl)methylsulfanyl]benzimidazole-5-sulfonamide (PubChem CID 46097905) has the molecular formula C23H22F3N3O3S2 and a molecular weight of 509.58 g/mol. Its IUPAC name is N,N-diethyl-1-(furan-2-ylmethyl)-2-[(2,4,5-trifluorophenyl)methylsulfanyl]benzimidazole-5-sulfonamide.
| Compound Name | N,N-diethyl-1-(furan-2-ylmethyl)-2-[(2,4,5-trifluorophenyl)methylsulfanyl]benzimidazole-5-sulfonamide |
|---|---|
| PubChem CID | 46097905 |
| Molecular Formula | C23H22F3N3O3S2 |
| Molecular Weight | 509.58 g/mol |
| Exact Mass | 509.11 |
| IUPAC Name | N,N-diethyl-1-(furan-2-ylmethyl)-2-[(2,4,5-trifluorophenyl)methylsulfanyl]benzimidazole-5-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc2c(c1)nc(SCc1cc(F)c(F)cc1F)n2Cc1ccco1 |
| InChI | InChI=1S/C23H22F3N3O3S2/c1-3-28(4-2)34(30,31)17-7-8-22-21(11-17)27-23(29(22)13-16-6-5-9-32-16)33-14-15-10-19(25)20(26)12-18(15)24/h5-12H,3-4,13-14H2,1-2H3 |
| InChIKey | STYIEYMJNHTQJT-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 68.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.58 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|