C27H34N2O5 — CID 46100191
benzyl N-[4-oxo-4-[2-(5,6,7,8-tetrahydronaphthalen-2-yloxymethyl)morpholin-4-yl]butyl]carbamate (PubChem CID 46100191) has the molecular formula C27H34N2O5 and a molecular weight of 466.58 g/mol. Its IUPAC name is benzyl N-[4-oxo-4-[2-(5,6,7,8-tetrahydronaphthalen-2-yloxymethyl)morpholin-4-yl]butyl]carbamate.
| Compound Name | benzyl N-[4-oxo-4-[2-(5,6,7,8-tetrahydronaphthalen-2-yloxymethyl)morpholin-4-yl]butyl]carbamate |
|---|---|
| PubChem CID | 46100191 |
| Molecular Formula | C27H34N2O5 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.25 |
| IUPAC Name | benzyl N-[4-oxo-4-[2-(5,6,7,8-tetrahydronaphthalen-2-yloxymethyl)morpholin-4-yl]butyl]carbamate |
| SMILES | O=C(NCCCC(=O)N1CCOC(COc2ccc3c(c2)CCCC3)C1)OCc1ccccc1 |
| InChI | InChI=1S/C27H34N2O5/c30-26(11-6-14-28-27(31)34-19-21-7-2-1-3-8-21)29-15-16-32-25(18-29)20-33-24-13-12-22-9-4-5-10-23(22)17-24/h1-3,7-8,12-13,17,25H,4-6,9-11,14-16,18-20H2,(H,28,31) |
| InChIKey | SHWHBNBNXWVXSY-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|