C28H25FN2O4 — CID 46101902
ethyl 1-benzyl-3-[(2-fluorobenzoyl)amino]-4-(4-methoxyphenyl)pyrrole-2-carboxylate (PubChem CID 46101902) has the molecular formula C28H25FN2O4 and a molecular weight of 472.52 g/mol. Its IUPAC name is ethyl 1-benzyl-3-[(2-fluorobenzoyl)amino]-4-(4-methoxyphenyl)pyrrole-2-carboxylate.
| Compound Name | ethyl 1-benzyl-3-[(2-fluorobenzoyl)amino]-4-(4-methoxyphenyl)pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 46101902 |
| Molecular Formula | C28H25FN2O4 |
| Molecular Weight | 472.52 g/mol |
| Exact Mass | 472.18 |
| IUPAC Name | ethyl 1-benzyl-3-[(2-fluorobenzoyl)amino]-4-(4-methoxyphenyl)pyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)c2ccccc2F)c(-c2ccc(OC)cc2)cn1Cc1ccccc1 |
| InChI | InChI=1S/C28H25FN2O4/c1-3-35-28(33)26-25(30-27(32)22-11-7-8-12-24(22)29)23(20-13-15-21(34-2)16-14-20)18-31(26)17-19-9-5-4-6-10-19/h4-16,18H,3,17H2,1-2H3,(H,30,32) |
| InChIKey | CEFWUAPRAVMEQV-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.52 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |