C25H27FN2O3 — CID 92769872
ethyl 1-benzyl-4-(3-fluorophenyl)-3-[[(2R)-2-methylbutanoyl]amino]pyrrole-2-carboxylate (PubChem CID 92769872) has the molecular formula C25H27FN2O3 and a molecular weight of 422.50 g/mol. Its IUPAC name is ethyl 1-benzyl-4-(3-fluorophenyl)-3-[[(2R)-2-methylbutanoyl]amino]pyrrole-2-carboxylate.
| Compound Name | ethyl 1-benzyl-4-(3-fluorophenyl)-3-[[(2R)-2-methylbutanoyl]amino]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 92769872 |
| Molecular Formula | C25H27FN2O3 |
| Molecular Weight | 422.50 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | ethyl 1-benzyl-4-(3-fluorophenyl)-3-[[(2R)-2-methylbutanoyl]amino]pyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)[C@H](C)CC)c(-c2cccc(F)c2)cn1Cc1ccccc1 |
| InChI | InChI=1S/C25H27FN2O3/c1-4-17(3)24(29)27-22-21(19-12-9-13-20(26)14-19)16-28(23(22)25(30)31-5-2)15-18-10-7-6-8-11-18/h6-14,16-17H,4-5,15H2,1-3H3,(H,27,29)/t17-/m1/s1 |
| InChIKey | CFFKAKNRPANWJG-QGZVFWFLSA-N |
| XLogP | 5.50 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.50 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |