About ethyl 1-benzyl-3-[(2,5-difluorobenzoyl)amino]-4-(4-methoxyphenyl)pyrrole-2-carboxylate
ethyl 1-benzyl-3-[(2,5-difluorobenzoyl)amino]-4-(4-methoxyphenyl)pyrrole-2-carboxylate (PubChem CID 24720823) has the molecular formula C28H24F2N2O4
and a molecular weight of 490.51 g/mol. Its IUPAC name is ethyl 1-benzyl-3-[(2,5-difluorobenzoyl)amino]-4-(4-methoxyphenyl)pyrrole-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-benzyl-3-[(2,5-difluorobenzoyl)amino]-4-(4-methoxyphenyl)pyrrole-2-carboxylate |
| PubChem CID | 24720823 |
| Molecular Formula | C28H24F2N2O4 |
| Molecular Weight | 490.51 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | ethyl 1-benzyl-3-[(2,5-difluorobenzoyl)amino]-4-(4-methoxyphenyl)pyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)c2cc(F)ccc2F)c(-c2ccc(OC)cc2)cn1Cc1ccccc1 |
| InChI | InChI=1S/C28H24F2N2O4/c1-3-36-28(34)26-25(31-27(33)22-15-20(29)11-14-24(22)30)23(19-9-12-21(35-2)13-10-19)17-32(26)16-18-7-5-4-6-8-18/h4-15,17H,3,16H2,1-2H3,(H,31,33) |
| InChIKey | SMBZFTSMXUVZLC-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 490.51 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 1-benzyl-3-[(2,5-difluorobenzoyl)amino]-4-(4-methoxyphenyl)pyrrole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-benzyl-3-[(2,5-difluorobenzoyl)amino]-4-(4-methoxyphenyl)pyrrole-2-carboxylate?
The IUPAC name of ethyl 1-benzyl-3-[(2,5-difluorobenzoyl)amino]-4-(4-methoxyphenyl)pyrrole-2-carboxylate (CID 24720823) is ethyl 1-benzyl-3-[(2,5-difluorobenzoyl)amino]-4-(4-methoxyphenyl)pyrrole-2-carboxylate.
What is the SMILES notation for ethyl 1-benzyl-3-[(2,5-difluorobenzoyl)amino]-4-(4-methoxyphenyl)pyrrole-2-carboxylate?
The canonical SMILES for ethyl 1-benzyl-3-[(2,5-difluorobenzoyl)amino]-4-(4-methoxyphenyl)pyrrole-2-carboxylate is CCOC(=O)c1c(NC(=O)c2cc(F)ccc2F)c(-c2ccc(OC)cc2)cn1Cc1ccccc1.
What is the InChIKey of ethyl 1-benzyl-3-[(2,5-difluorobenzoyl)amino]-4-(4-methoxyphenyl)pyrrole-2-carboxylate?
The InChIKey is SMBZFTSMXUVZLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H24F2N2O4/c1-3-36-28(34)26-25(31-27(33)22-15-20(29)11-14-24(22)30)23(19-9-12-21(35-2)13-10-19)17-32(26)16-18-7-5-4-6-8-18/h4-15,17H,3,16H2,1-2H3,(H,31,33).
What are the key properties of ethyl 1-benzyl-3-[(2,5-difluorobenzoyl)amino]-4-(4-methoxyphenyl)pyrrole-2-carboxylate?
ethyl 1-benzyl-3-[(2,5-difluorobenzoyl)amino]-4-(4-methoxyphenyl)pyrrole-2-carboxylate has a molecular weight of 490.51 g/mol, XLogP of 5.92, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-benzyl-3-[(2,5-difluorobenzoyl)amino]-4-(4-methoxyphenyl)pyrrole-2-carboxylate is sourced from PubChem (CID 24720823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).