C19H18ClN3O3 — CID 46107097
N-[1-(4-chlorophenyl)-5-methylpyrazol-3-yl]-3,5-dimethoxybenzamide (PubChem CID 46107097) has the molecular formula C19H18ClN3O3 and a molecular weight of 371.82 g/mol. Its IUPAC name is N-[1-(4-chlorophenyl)-5-methylpyrazol-3-yl]-3,5-dimethoxybenzamide.
| Compound Name | N-[1-(4-chlorophenyl)-5-methylpyrazol-3-yl]-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 46107097 |
| Molecular Formula | C19H18ClN3O3 |
| Molecular Weight | 371.82 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | N-[1-(4-chlorophenyl)-5-methylpyrazol-3-yl]-3,5-dimethoxybenzamide |
| SMILES | COc1cc(OC)cc(C(=O)Nc2cc(C)n(-c3ccc(Cl)cc3)n2)c1 |
| InChI | InChI=1S/C19H18ClN3O3/c1-12-8-18(22-23(12)15-6-4-14(20)5-7-15)21-19(24)13-9-16(25-2)11-17(10-13)26-3/h4-11H,1-3H3,(H,21,22,24) |
| InChIKey | FNRLILWCTRSGFX-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.82 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |