C30H35F3N4O — CID 46131495
1-[4-[5-benzyl-6-methyl-2-[3-(trifluoromethyl)phenyl]pyrimidin-4-yl]piperazin-1-yl]heptan-1-one (PubChem CID 46131495) has the molecular formula C30H35F3N4O and a molecular weight of 524.63 g/mol. Its IUPAC name is 1-[4-[5-benzyl-6-methyl-2-[3-(trifluoromethyl)phenyl]pyrimidin-4-yl]piperazin-1-yl]heptan-1-one.
| Compound Name | 1-[4-[5-benzyl-6-methyl-2-[3-(trifluoromethyl)phenyl]pyrimidin-4-yl]piperazin-1-yl]heptan-1-one |
|---|---|
| PubChem CID | 46131495 |
| Molecular Formula | C30H35F3N4O |
| Molecular Weight | 524.63 g/mol |
| Exact Mass | 524.28 |
| IUPAC Name | 1-[4-[5-benzyl-6-methyl-2-[3-(trifluoromethyl)phenyl]pyrimidin-4-yl]piperazin-1-yl]heptan-1-one |
| SMILES | CCCCCCC(=O)N1CCN(c2nc(-c3cccc(C(F)(F)F)c3)nc(C)c2Cc2ccccc2)CC1 |
| InChI | InChI=1S/C30H35F3N4O/c1-3-4-5-9-15-27(38)36-16-18-37(19-17-36)29-26(20-23-11-7-6-8-12-23)22(2)34-28(35-29)24-13-10-14-25(21-24)30(31,32)33/h6-8,10-14,21H,3-5,9,15-20H2,1-2H3 |
| InChIKey | XHSYSXFZHUTELT-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.63 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|