C13H25F3N2O3S — CID 46176570
trans-(1R,2R)-2-N-cyclohexylcyclohexane-1,2-diamine;trifluoromethanesulfonic acid (PubChem CID 46176570) has the molecular formula C13H25F3N2O3S and a molecular weight of 346.42 g/mol. Its IUPAC name is trans-(1R,2R)-2-N-cyclohexylcyclohexane-1,2-diamine;trifluoromethanesulfonic acid.
| Compound Name | trans-(1R,2R)-2-N-cyclohexylcyclohexane-1,2-diamine;trifluoromethanesulfonic acid |
|---|---|
| PubChem CID | 46176570 |
| Molecular Formula | C13H25F3N2O3S |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | trans-(1R,2R)-2-N-cyclohexylcyclohexane-1,2-diamine;trifluoromethanesulfonic acid |
| SMILES | N[C@@H]1CCCC[C@H]1NC1CCCCC1.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C12H24N2.CHF3O3S/c13-11-8-4-5-9-12(11)14-10-6-2-1-3-7-10;2-1(3,4)8(5,6)7/h10-12,14H,1-9,13H2;(H,5,6,7)/t11-,12-;/m1./s1 |
| InChIKey | OYKGCXNPMCYHPD-MNMPKAIFSA-N |
| XLogP | 2.57 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|