C25H22ClNO2S3 — CID 46177634
[1-(4-chlorophenyl)-3-oxo-3-phenoxathiin-2-ylpropyl] N-propylcarbamodithioate (PubChem CID 46177634) has the molecular formula C25H22ClNO2S3 and a molecular weight of 500.11 g/mol. Its IUPAC name is [1-(4-chlorophenyl)-3-oxo-3-phenoxathiin-2-ylpropyl] N-propylcarbamodithioate.
| Compound Name | [1-(4-chlorophenyl)-3-oxo-3-phenoxathiin-2-ylpropyl] N-propylcarbamodithioate |
|---|---|
| PubChem CID | 46177634 |
| Molecular Formula | C25H22ClNO2S3 |
| Molecular Weight | 500.11 g/mol |
| Exact Mass | 499.05 |
| IUPAC Name | [1-(4-chlorophenyl)-3-oxo-3-phenoxathiin-2-ylpropyl] N-propylcarbamodithioate |
| SMILES | CCCNC(=S)SC(CC(=O)c1ccc2c(c1)Sc1ccccc1O2)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H22ClNO2S3/c1-2-13-27-25(30)32-23(16-7-10-18(26)11-8-16)15-19(28)17-9-12-21-24(14-17)31-22-6-4-3-5-20(22)29-21/h3-12,14,23H,2,13,15H2,1H3,(H,27,30) |
| InChIKey | GAXKDZNZAOIBLA-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.11 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|