C25H45NO6Si — CID 46180294
2-trimethylsilylethyl (2S,3R)-2-methyl-3-[(2S,3R)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]oxyoct-7-ynoate (PubChem CID 46180294) has the molecular formula C25H45NO6Si and a molecular weight of 483.72 g/mol. Its IUPAC name is 2-trimethylsilylethyl (2S,3R)-2-methyl-3-[(2S,3R)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]oxyoct-7-ynoate.
| Compound Name | 2-trimethylsilylethyl (2S,3R)-2-methyl-3-[(2S,3R)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]oxyoct-7-ynoate |
|---|---|
| PubChem CID | 46180294 |
| Molecular Formula | C25H45NO6Si |
| Molecular Weight | 483.72 g/mol |
| Exact Mass | 483.30 |
| IUPAC Name | 2-trimethylsilylethyl (2S,3R)-2-methyl-3-[(2S,3R)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]oxyoct-7-ynoate |
| SMILES | C#CCCC[C@@H](OC(=O)[C@@H](NC(=O)OC(C)(C)C)[C@H](C)CC)[C@H](C)C(=O)OCC[Si](C)(C)C |
| InChI | InChI=1S/C25H45NO6Si/c1-11-13-14-15-20(19(4)22(27)30-16-17-33(8,9)10)31-23(28)21(18(3)12-2)26-24(29)32-25(5,6)7/h1,18-21H,12-17H2,2-10H3,(H,26,29)/t18-,19+,20-,21+/m1/s1 |
| InChIKey | BYTNYPXCHPQPNY-MHTWAQMVSA-N |
| XLogP | 5.16 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.72 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|