C23H15N3OS — CID 46183585
5-methylsulfanyl-1,3-diphenylfuro[3,2-e]indazole-4-carbonitrile (PubChem CID 46183585) has the molecular formula C23H15N3OS and a molecular weight of 381.46 g/mol. Its IUPAC name is 5-methylsulfanyl-1,3-diphenylfuro[3,2-e]indazole-4-carbonitrile.
| Compound Name | 5-methylsulfanyl-1,3-diphenylfuro[3,2-e]indazole-4-carbonitrile |
|---|---|
| PubChem CID | 46183585 |
| Molecular Formula | C23H15N3OS |
| Molecular Weight | 381.46 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | 5-methylsulfanyl-1,3-diphenylfuro[3,2-e]indazole-4-carbonitrile |
| SMILES | CSc1c(C#N)c2c(c(-c3ccccc3)nn2-c2ccccc2)c2ccoc12 |
| InChI | InChI=1S/C23H15N3OS/c1-28-23-18(14-24)21-19(17-12-13-27-22(17)23)20(15-8-4-2-5-9-15)25-26(21)16-10-6-3-7-11-16/h2-13H,1H3 |
| InChIKey | NWWHLOYHDFYVAR-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 54.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.46 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |