C25H21N3OS — CID 46183745
N-[(E)-1,3-benzothiazol-6-ylmethylideneamino]-2-methyl-2-(4-phenylphenyl)cyclopropane-1-carboxamide (PubChem CID 46183745) has the molecular formula C25H21N3OS and a molecular weight of 411.53 g/mol. Its IUPAC name is N-[(E)-1,3-benzothiazol-6-ylmethylideneamino]-2-methyl-2-(4-phenylphenyl)cyclopropane-1-carboxamide.
| Compound Name | N-[(E)-1,3-benzothiazol-6-ylmethylideneamino]-2-methyl-2-(4-phenylphenyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 46183745 |
| Molecular Formula | C25H21N3OS |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | N-[(E)-1,3-benzothiazol-6-ylmethylideneamino]-2-methyl-2-(4-phenylphenyl)cyclopropane-1-carboxamide |
| SMILES | CC1(c2ccc(-c3ccccc3)cc2)CC1C(=O)N/N=C/c1ccc2ncsc2c1 |
| InChI | InChI=1S/C25H21N3OS/c1-25(20-10-8-19(9-11-20)18-5-3-2-4-6-18)14-21(25)24(29)28-27-15-17-7-12-22-23(13-17)30-16-26-22/h2-13,15-16,21H,14H2,1H3,(H,28,29)/b27-15+ |
| InChIKey | ANLWHSWIYHAVKY-JFLMPSFJSA-N |
| XLogP | 5.39 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|