C26H27NO5S — CID 46183956
1'-[(2R)-2-hydroxy-3-(2-methylphenoxy)propyl]spiro[3H-benzo[h][1,4]benzoxathiine-2,4'-piperidine]-5,6-dione (PubChem CID 46183956) has the molecular formula C26H27NO5S and a molecular weight of 465.57 g/mol. Its IUPAC name is 1'-[(2R)-2-hydroxy-3-(2-methylphenoxy)propyl]spiro[3H-benzo[h][1,4]benzoxathiine-2,4'-piperidine]-5,6-dione.
| Compound Name | 1'-[(2R)-2-hydroxy-3-(2-methylphenoxy)propyl]spiro[3H-benzo[h][1,4]benzoxathiine-2,4'-piperidine]-5,6-dione |
|---|---|
| PubChem CID | 46183956 |
| Molecular Formula | C26H27NO5S |
| Molecular Weight | 465.57 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | 1'-[(2R)-2-hydroxy-3-(2-methylphenoxy)propyl]spiro[3H-benzo[h][1,4]benzoxathiine-2,4'-piperidine]-5,6-dione |
| SMILES | Cc1ccccc1OC[C@H](O)CN1CCC2(CC1)CSC1=C(O2)c2ccccc2C(=O)C1=O |
| InChI | InChI=1S/C26H27NO5S/c1-17-6-2-5-9-21(17)31-15-18(28)14-27-12-10-26(11-13-27)16-33-25-23(30)22(29)19-7-3-4-8-20(19)24(25)32-26/h2-9,18,28H,10-16H2,1H3/t18-/m1/s1 |
| InChIKey | JKTLJOWLVBNYRO-GOSISDBHSA-N |
| XLogP | 3.47 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.57 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|