C29H33NO5S — CID 23654788
1'-[3-(4-tert-butylphenoxy)-2-hydroxypropyl]spiro[3H-benzo[h][1,4]benzoxathiine-2,4'-piperidine]-5,6-dione (PubChem CID 23654788) has the molecular formula C29H33NO5S and a molecular weight of 507.65 g/mol. Its IUPAC name is 1'-[3-(4-tert-butylphenoxy)-2-hydroxypropyl]spiro[3H-benzo[h][1,4]benzoxathiine-2,4'-piperidine]-5,6-dione.
| Compound Name | 1'-[3-(4-tert-butylphenoxy)-2-hydroxypropyl]spiro[3H-benzo[h][1,4]benzoxathiine-2,4'-piperidine]-5,6-dione |
|---|---|
| PubChem CID | 23654788 |
| Molecular Formula | C29H33NO5S |
| Molecular Weight | 507.65 g/mol |
| Exact Mass | 507.21 |
| IUPAC Name | 1'-[3-(4-tert-butylphenoxy)-2-hydroxypropyl]spiro[3H-benzo[h][1,4]benzoxathiine-2,4'-piperidine]-5,6-dione |
| SMILES | CC(C)(C)c1ccc(OCC(O)CN2CCC3(CC2)CSC2=C(O3)c3ccccc3C(=O)C2=O)cc1 |
| InChI | InChI=1S/C29H33NO5S/c1-28(2,3)19-8-10-21(11-9-19)34-17-20(31)16-30-14-12-29(13-15-30)18-36-27-25(33)24(32)22-6-4-5-7-23(22)26(27)35-29/h4-11,20,31H,12-18H2,1-3H3 |
| InChIKey | CPBNZUBZIGFVIC-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.65 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|