C13H18N2O3S — CID 46186602
prop-2-enyl N-(3-acetamido-2-thiophen-3-ylpropyl)carbamate (PubChem CID 46186602) has the molecular formula C13H18N2O3S and a molecular weight of 282.37 g/mol. Its IUPAC name is prop-2-enyl N-(3-acetamido-2-thiophen-3-ylpropyl)carbamate.
| Compound Name | prop-2-enyl N-(3-acetamido-2-thiophen-3-ylpropyl)carbamate |
|---|---|
| PubChem CID | 46186602 |
| Molecular Formula | C13H18N2O3S |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | prop-2-enyl N-(3-acetamido-2-thiophen-3-ylpropyl)carbamate |
| SMILES | C=CCOC(=O)NCC(CNC(C)=O)c1ccsc1 |
| InChI | InChI=1S/C13H18N2O3S/c1-3-5-18-13(17)15-8-12(7-14-10(2)16)11-4-6-19-9-11/h3-4,6,9,12H,1,5,7-8H2,2H3,(H,14,16)(H,15,17) |
| InChIKey | ZGKLAMFDQULWTF-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|