C29H31N5O — CID 46187414
N-[(Z)-[(E,1E)-1-[(4-methylphenyl)hydrazinylidene]-4-phenyl-1-piperidin-1-ylbut-3-en-2-ylidene]amino]benzamide (PubChem CID 46187414) has the molecular formula C29H31N5O and a molecular weight of 465.60 g/mol. Its IUPAC name is N-[(Z)-[(E,1E)-1-[(4-methylphenyl)hydrazinylidene]-4-phenyl-1-piperidin-1-ylbut-3-en-2-ylidene]amino]benzamide.
| Compound Name | N-[(Z)-[(E,1E)-1-[(4-methylphenyl)hydrazinylidene]-4-phenyl-1-piperidin-1-ylbut-3-en-2-ylidene]amino]benzamide |
|---|---|
| PubChem CID | 46187414 |
| Molecular Formula | C29H31N5O |
| Molecular Weight | 465.60 g/mol |
| Exact Mass | 465.25 |
| IUPAC Name | N-[(Z)-[(E,1E)-1-[(4-methylphenyl)hydrazinylidene]-4-phenyl-1-piperidin-1-ylbut-3-en-2-ylidene]amino]benzamide |
| SMILES | Cc1ccc(N/N=C(C(\C=C\c2ccccc2)=N/NC(=O)c2ccccc2)/N2CCCCC2)cc1 |
| InChI | InChI=1S/C29H31N5O/c1-23-15-18-26(19-16-23)30-32-28(34-21-9-4-10-22-34)27(20-17-24-11-5-2-6-12-24)31-33-29(35)25-13-7-3-8-14-25/h2-3,5-8,11-20,30H,4,9-10,21-22H2,1H3,(H,33,35)/b20-17+,31-27-,32-28+ |
| InChIKey | YAEQSCRKDVWNIN-FETDISAPSA-N |
| XLogP | 5.71 |
| TPSA | 69.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.60 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|