C22H27N3O — CID 92530158
N-[(Z)-[(E,4S)-5-(dimethylamino)-4-methyl-1-(4-methylphenyl)pent-1-en-3-ylidene]amino]benzamide (PubChem CID 92530158) has the molecular formula C22H27N3O and a molecular weight of 349.48 g/mol. Its IUPAC name is N-[(Z)-[(E,4S)-5-(dimethylamino)-4-methyl-1-(4-methylphenyl)pent-1-en-3-ylidene]amino]benzamide.
| Compound Name | N-[(Z)-[(E,4S)-5-(dimethylamino)-4-methyl-1-(4-methylphenyl)pent-1-en-3-ylidene]amino]benzamide |
|---|---|
| PubChem CID | 92530158 |
| Molecular Formula | C22H27N3O |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.22 |
| IUPAC Name | N-[(Z)-[(E,4S)-5-(dimethylamino)-4-methyl-1-(4-methylphenyl)pent-1-en-3-ylidene]amino]benzamide |
| SMILES | Cc1ccc(/C=C/C(=N/NC(=O)c2ccccc2)[C@@H](C)CN(C)C)cc1 |
| InChI | InChI=1S/C22H27N3O/c1-17-10-12-19(13-11-17)14-15-21(18(2)16-25(3)4)23-24-22(26)20-8-6-5-7-9-20/h5-15,18H,16H2,1-4H3,(H,24,26)/b15-14+,23-21-/t18-/m0/s1 |
| InChIKey | UKCRSDLYVLZMKP-CNTQNIPESA-N |
| XLogP | 3.99 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|