C20H25N3 — CID 92530142
N-[(Z)-[(Z,4S)-5-(dimethylamino)-4-methyl-1-phenylpent-1-en-3-ylidene]amino]aniline (PubChem CID 92530142) has the molecular formula C20H25N3 and a molecular weight of 307.44 g/mol. Its IUPAC name is N-[(Z)-[(Z,4S)-5-(dimethylamino)-4-methyl-1-phenylpent-1-en-3-ylidene]amino]aniline.
| Compound Name | N-[(Z)-[(Z,4S)-5-(dimethylamino)-4-methyl-1-phenylpent-1-en-3-ylidene]amino]aniline |
|---|---|
| PubChem CID | 92530142 |
| Molecular Formula | C20H25N3 |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.20 |
| IUPAC Name | N-[(Z)-[(Z,4S)-5-(dimethylamino)-4-methyl-1-phenylpent-1-en-3-ylidene]amino]aniline |
| SMILES | C[C@@H](CN(C)C)C(/C=C\c1ccccc1)=N\Nc1ccccc1 |
| InChI | InChI=1S/C20H25N3/c1-17(16-23(2)3)20(15-14-18-10-6-4-7-11-18)22-21-19-12-8-5-9-13-19/h4-15,17,21H,16H2,1-3H3/b15-14-,22-20-/t17-/m0/s1 |
| InChIKey | TXBAASCQNLBKGH-HKDAAGMHSA-N |
| XLogP | 4.37 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|