C23H23N3 — CID 2750014
N,N-dimethyl-4-[3-phenyl-3-(phenylhydrazinylidene)prop-1-enyl]aniline (PubChem CID 2750014) has the molecular formula C23H23N3 and a molecular weight of 341.46 g/mol. Its IUPAC name is N,N-dimethyl-4-[3-phenyl-3-(phenylhydrazinylidene)prop-1-enyl]aniline.
| Compound Name | N,N-dimethyl-4-[3-phenyl-3-(phenylhydrazinylidene)prop-1-enyl]aniline |
|---|---|
| PubChem CID | 2750014 |
| Molecular Formula | C23H23N3 |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | N,N-dimethyl-4-[3-phenyl-3-(phenylhydrazinylidene)prop-1-enyl]aniline |
| SMILES | CN(C)c1ccc(C=CC(=NNc2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H23N3/c1-26(2)22-16-13-19(14-17-22)15-18-23(20-9-5-3-6-10-20)25-24-21-11-7-4-8-12-21/h3-18,24H,1-2H3 |
| InChIKey | PGXVQLMSRMMTSF-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|