C20H26ClN3 — CID 6514853
N-[(Z)-[(E)-5-(dimethylamino)-4-methyl-1-phenylpent-1-en-3-ylidene]amino]aniline;hydrochloride (PubChem CID 6514853) has the molecular formula C20H26ClN3 and a molecular weight of 343.90 g/mol. Its IUPAC name is N-[(Z)-[(E)-5-(dimethylamino)-4-methyl-1-phenylpent-1-en-3-ylidene]amino]aniline;hydrochloride.
| Compound Name | N-[(Z)-[(E)-5-(dimethylamino)-4-methyl-1-phenylpent-1-en-3-ylidene]amino]aniline;hydrochloride |
|---|---|
| PubChem CID | 6514853 |
| Molecular Formula | C20H26ClN3 |
| Molecular Weight | 343.90 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | N-[(Z)-[(E)-5-(dimethylamino)-4-methyl-1-phenylpent-1-en-3-ylidene]amino]aniline;hydrochloride |
| SMILES | CC(CN(C)C)C(/C=C/c1ccccc1)=N\Nc1ccccc1.Cl |
| InChI | InChI=1S/C20H25N3.ClH/c1-17(16-23(2)3)20(15-14-18-10-6-4-7-11-18)22-21-19-12-8-5-9-13-19;/h4-15,17,21H,16H2,1-3H3;1H/b15-14+,22-20-; |
| InChIKey | ZSWCDUGCDQTNQP-WCLHPINPSA-N |
| XLogP | 4.79 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.90 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|