About (3R)-1,3-dihydroxyoctan-2-one
(3R)-1,3-dihydroxyoctan-2-one (PubChem CID 46187641) has the molecular formula C8H16O3
and a molecular weight of 160.21 g/mol. Its IUPAC name is (3R)-1,3-dihydroxyoctan-2-one.
Molecular Properties
| Compound Name | (3R)-1,3-dihydroxyoctan-2-one |
| PubChem CID | 46187641 |
| Molecular Formula | C8H16O3 |
| Molecular Weight | 160.21 g/mol |
| Exact Mass | 160.11 |
| IUPAC Name | (3R)-1,3-dihydroxyoctan-2-one |
| SMILES | CCCCC[C@@H](O)C(=O)CO |
| InChI | InChI=1S/C8H16O3/c1-2-3-4-5-7(10)8(11)6-9/h7,9-10H,2-6H2,1H3/t7-/m1/s1 |
| InChIKey | BWTPHMJAKKAMBH-SSDOTTSWSA-N |
| XLogP | 0.49 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.21 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (3R)-1,3-dihydroxyoctan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-1,3-dihydroxyoctan-2-one?
The IUPAC name of (3R)-1,3-dihydroxyoctan-2-one (CID 46187641) is (3R)-1,3-dihydroxyoctan-2-one.
What is the SMILES notation for (3R)-1,3-dihydroxyoctan-2-one?
The canonical SMILES for (3R)-1,3-dihydroxyoctan-2-one is CCCCC[C@@H](O)C(=O)CO.
What is the InChIKey of (3R)-1,3-dihydroxyoctan-2-one?
The InChIKey is BWTPHMJAKKAMBH-SSDOTTSWSA-N. The full InChI is InChI=1S/C8H16O3/c1-2-3-4-5-7(10)8(11)6-9/h7,9-10H,2-6H2,1H3/t7-/m1/s1.
What are the key properties of (3R)-1,3-dihydroxyoctan-2-one?
(3R)-1,3-dihydroxyoctan-2-one has a molecular weight of 160.21 g/mol, XLogP of 0.49, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-1,3-dihydroxyoctan-2-one is sourced from PubChem (CID 46187641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).