C38H69NO2 — CID 46187857
1-[(4S)-2,2-bis[(8Z,10Z)-hexadeca-8,10-dienyl]-1,3-dioxolan-4-yl]-N,N-dimethylmethanamine (PubChem CID 46187857) has the molecular formula C38H69NO2 and a molecular weight of 571.98 g/mol. Its IUPAC name is 1-[(4S)-2,2-bis[(8Z,10Z)-hexadeca-8,10-dienyl]-1,3-dioxolan-4-yl]-N,N-dimethylmethanamine.
| Compound Name | 1-[(4S)-2,2-bis[(8Z,10Z)-hexadeca-8,10-dienyl]-1,3-dioxolan-4-yl]-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 46187857 |
| Molecular Formula | C38H69NO2 |
| Molecular Weight | 571.98 g/mol |
| Exact Mass | 571.53 |
| IUPAC Name | 1-[(4S)-2,2-bis[(8Z,10Z)-hexadeca-8,10-dienyl]-1,3-dioxolan-4-yl]-N,N-dimethylmethanamine |
| SMILES | CCCCC/C=C\C=C/CCCCCCCC1(CCCCCCC/C=C\C=C/CCCCC)OC[C@H](CN(C)C)O1 |
| InChI | InChI=1S/C38H69NO2/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-38(40-36-37(41-38)35-39(3)4)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h13-20,37H,5-12,21-36H2,1-4H3/b15-13-,16-14-,19-17-,20-18-/t37-/m0/s1 |
| InChIKey | YOPPUFMYCKETLB-RDQRFZQHSA-N |
| XLogP | 11.51 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.98 |
| LogP ≤ 5 | 11.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|