C26H26N3NaO3 — CID 46193002
sodium (2S)-3-methyl-2-[[9-(3-phenylpropyl)pyrido[3,4-b]indole-3-carbonyl]amino]butanoate (PubChem CID 46193002) has the molecular formula C26H26N3NaO3 and a molecular weight of 451.50 g/mol. Its IUPAC name is sodium (2S)-3-methyl-2-[[9-(3-phenylpropyl)pyrido[3,4-b]indole-3-carbonyl]amino]butanoate.
| Compound Name | sodium (2S)-3-methyl-2-[[9-(3-phenylpropyl)pyrido[3,4-b]indole-3-carbonyl]amino]butanoate |
|---|---|
| PubChem CID | 46193002 |
| Molecular Formula | C26H26N3NaO3 |
| Molecular Weight | 451.50 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | sodium (2S)-3-methyl-2-[[9-(3-phenylpropyl)pyrido[3,4-b]indole-3-carbonyl]amino]butanoate |
| SMILES | CC(C)[C@H](NC(=O)c1cc2c3ccccc3n(CCCc3ccccc3)c2cn1)C(=O)[O-].[Na+] |
| InChI | InChI=1S/C26H27N3O3.Na/c1-17(2)24(26(31)32)28-25(30)21-15-20-19-12-6-7-13-22(19)29(23(20)16-27-21)14-8-11-18-9-4-3-5-10-18;/h3-7,9-10,12-13,15-17,24H,8,11,14H2,1-2H3,(H,28,30)(H,31,32);/q;+1/p-1/t24-;/m0./s1 |
| InChIKey | CFFRHIPLJNJCCC-JIDHJSLPSA-M |
| XLogP | 0.33 |
| TPSA | 87.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.50 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |