C16H19N3O5 — CID 46196055
[(3aR,5R,6S,6aR)-5-(azidomethyl)-2,2,6-trimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-6-yl] benzoate (PubChem CID 46196055) has the molecular formula C16H19N3O5 and a molecular weight of 333.34 g/mol. Its IUPAC name is [(3aR,5R,6S,6aR)-5-(azidomethyl)-2,2,6-trimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-6-yl] benzoate.
| Compound Name | [(3aR,5R,6S,6aR)-5-(azidomethyl)-2,2,6-trimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-6-yl] benzoate |
|---|---|
| PubChem CID | 46196055 |
| Molecular Formula | C16H19N3O5 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | [(3aR,5R,6S,6aR)-5-(azidomethyl)-2,2,6-trimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-6-yl] benzoate |
| SMILES | CC1(C)O[C@H]2O[C@H](CN=[N+]=[N-])[C@](C)(OC(=O)c3ccccc3)[C@H]2O1 |
| InChI | InChI=1S/C16H19N3O5/c1-15(2)22-12-14(24-15)21-11(9-18-19-17)16(12,3)23-13(20)10-7-5-4-6-8-10/h4-8,11-12,14H,9H2,1-3H3/t11-,12+,14-,16+/m1/s1 |
| InChIKey | QKQTYTZMGIRHJR-FIRUKDTASA-N |
| XLogP | 2.79 |
| TPSA | 102.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|