C17H12ClN3OS — CID 46196524
3-[3-[[4-(3-chloro-4-pyridinyl)-1,3-thiazol-2-yl]amino]phenyl]prop-2-yn-1-ol (PubChem CID 46196524) has the molecular formula C17H12ClN3OS and a molecular weight of 341.82 g/mol. Its IUPAC name is 3-[3-[[4-(3-chloro-4-pyridinyl)-1,3-thiazol-2-yl]amino]phenyl]prop-2-yn-1-ol.
| Compound Name | 3-[3-[[4-(3-chloro-4-pyridinyl)-1,3-thiazol-2-yl]amino]phenyl]prop-2-yn-1-ol |
|---|---|
| PubChem CID | 46196524 |
| Molecular Formula | C17H12ClN3OS |
| Molecular Weight | 341.82 g/mol |
| Exact Mass | 341.04 |
| IUPAC Name | 3-[3-[[4-(3-chloro-4-pyridinyl)-1,3-thiazol-2-yl]amino]phenyl]prop-2-yn-1-ol |
| SMILES | OCC#Cc1cccc(Nc2nc(-c3ccncc3Cl)cs2)c1 |
| InChI | InChI=1S/C17H12ClN3OS/c18-15-10-19-7-6-14(15)16-11-23-17(21-16)20-13-5-1-3-12(9-13)4-2-8-22/h1,3,5-7,9-11,22H,8H2,(H,20,21) |
| InChIKey | KYCZQYUJQPUTNV-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.82 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|