C13H16N2O5 — CID 46198620
(5R,6R,7S,8S,8aR)-3-phenylimino-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridine-5,6,7,8-tetrol (PubChem CID 46198620) has the molecular formula C13H16N2O5 and a molecular weight of 280.28 g/mol. Its IUPAC name is (5R,6R,7S,8S,8aR)-3-phenylimino-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridine-5,6,7,8-tetrol.
| Compound Name | (5R,6R,7S,8S,8aR)-3-phenylimino-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridine-5,6,7,8-tetrol |
|---|---|
| PubChem CID | 46198620 |
| Molecular Formula | C13H16N2O5 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | (5R,6R,7S,8S,8aR)-3-phenylimino-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridine-5,6,7,8-tetrol |
| SMILES | O[C@@H]1[C@@H](O)[C@@H](O)N2/C(=N/c3ccccc3)OC[C@@H]2[C@@H]1O |
| InChI | InChI=1S/C13H16N2O5/c16-9-8-6-20-13(14-7-4-2-1-3-5-7)15(8)12(19)11(18)10(9)17/h1-5,8-12,16-19H,6H2/b14-13-/t8-,9+,10+,11-,12-/m1/s1 |
| InChIKey | XFFUNKHKRJZBGP-YFBRHDDBSA-N |
| XLogP | -1.21 |
| TPSA | 105.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|