C7H11NO5S — CID 11160354
(5R,6R,7R,8R,8aR)-5,6,7,8-tetrahydroxy-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridine-3-thione (PubChem CID 11160354) has the molecular formula C7H11NO5S and a molecular weight of 221.23 g/mol. Its IUPAC name is (5R,6R,7R,8R,8aR)-5,6,7,8-tetrahydroxy-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridine-3-thione.
| Compound Name | (5R,6R,7R,8R,8aR)-5,6,7,8-tetrahydroxy-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridine-3-thione |
|---|---|
| PubChem CID | 11160354 |
| Molecular Formula | C7H11NO5S |
| Molecular Weight | 221.23 g/mol |
| Exact Mass | 221.04 |
| IUPAC Name | (5R,6R,7R,8R,8aR)-5,6,7,8-tetrahydroxy-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridine-3-thione |
| SMILES | O[C@H]1[C@@H](O)[C@@H](O)N2C(=S)OC[C@@H]2[C@H]1O |
| InChI | InChI=1S/C7H11NO5S/c9-3-2-1-13-7(14)8(2)6(12)5(11)4(3)10/h2-6,9-12H,1H2/t2-,3-,4-,5-,6-/m1/s1 |
| InChIKey | SNYJQMJAGFMPAI-QZABAPFNSA-N |
| XLogP | -2.61 |
| TPSA | 93.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.23 |
| LogP ≤ 5 | -2.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|