C3H5NO2S — CID 87148419
4-hydroxy-1,3-oxazolidine-2-thione (PubChem CID 87148419) has the molecular formula C3H5NO2S and a molecular weight of 119.14 g/mol. Its IUPAC name is 4-hydroxy-1,3-oxazolidine-2-thione.
| Compound Name | 4-hydroxy-1,3-oxazolidine-2-thione |
|---|---|
| PubChem CID | 87148419 |
| Molecular Formula | C3H5NO2S |
| Molecular Weight | 119.14 g/mol |
| Exact Mass | 119.00 |
| IUPAC Name | 4-hydroxy-1,3-oxazolidine-2-thione |
| SMILES | OC1COC(=S)N1 |
| InChI | InChI=1S/C3H5NO2S/c5-2-1-6-3(7)4-2/h2,5H,1H2,(H,4,7) |
| InChIKey | DCVXAIYBSKCVQR-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 119.14 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|