C11H15NO3 — CID 156571183
8-propan-2-yl-3,4-dihydro-2H-1,4-benzoxazine-3,5-diol (PubChem CID 156571183) has the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. Its IUPAC name is 8-propan-2-yl-3,4-dihydro-2H-1,4-benzoxazine-3,5-diol.
| Compound Name | 8-propan-2-yl-3,4-dihydro-2H-1,4-benzoxazine-3,5-diol |
|---|---|
| PubChem CID | 156571183 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | 8-propan-2-yl-3,4-dihydro-2H-1,4-benzoxazine-3,5-diol |
| SMILES | CC(C)c1ccc(O)c2c1OCC(O)N2 |
| InChI | InChI=1S/C11H15NO3/c1-6(2)7-3-4-8(13)10-11(7)15-5-9(14)12-10/h3-4,6,9,12-14H,5H2,1-2H3 |
| InChIKey | PEEFBNIUXLIVPH-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|