C18H15ClFN3O4 — CID 46199761
N-(4-chloro-3-fluorophenyl)-N'-[1-(3-oxo-4H-1,4-benzoxazin-6-yl)ethyl]oxamide (PubChem CID 46199761) has the molecular formula C18H15ClFN3O4 and a molecular weight of 391.79 g/mol. Its IUPAC name is N-(4-chloro-3-fluorophenyl)-N'-[1-(3-oxo-4H-1,4-benzoxazin-6-yl)ethyl]oxamide.
| Compound Name | N-(4-chloro-3-fluorophenyl)-N'-[1-(3-oxo-4H-1,4-benzoxazin-6-yl)ethyl]oxamide |
|---|---|
| PubChem CID | 46199761 |
| Molecular Formula | C18H15ClFN3O4 |
| Molecular Weight | 391.79 g/mol |
| Exact Mass | 391.07 |
| IUPAC Name | N-(4-chloro-3-fluorophenyl)-N'-[1-(3-oxo-4H-1,4-benzoxazin-6-yl)ethyl]oxamide |
| SMILES | CC(NC(=O)C(=O)Nc1ccc(Cl)c(F)c1)c1ccc2c(c1)NC(=O)CO2 |
| InChI | InChI=1S/C18H15ClFN3O4/c1-9(10-2-5-15-14(6-10)23-16(24)8-27-15)21-17(25)18(26)22-11-3-4-12(19)13(20)7-11/h2-7,9H,8H2,1H3,(H,21,25)(H,22,26)(H,23,24) |
| InChIKey | NCFPUUVKYXSVSV-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.79 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|