C13H18Cl2F3N2+ — CID 46200856
[2-(dichloroamino)-2-methylpropyl]-dimethyl-[3-(trifluoromethyl)phenyl]azanium (PubChem CID 46200856) has the molecular formula C13H18Cl2F3N2+ and a molecular weight of 330.20 g/mol. Its IUPAC name is [2-(dichloroamino)-2-methylpropyl]-dimethyl-[3-(trifluoromethyl)phenyl]azanium.
| Compound Name | [2-(dichloroamino)-2-methylpropyl]-dimethyl-[3-(trifluoromethyl)phenyl]azanium |
|---|---|
| PubChem CID | 46200856 |
| Molecular Formula | C13H18Cl2F3N2+ |
| Molecular Weight | 330.20 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | [2-(dichloroamino)-2-methylpropyl]-dimethyl-[3-(trifluoromethyl)phenyl]azanium |
| SMILES | CC(C)(C[N+](C)(C)c1cccc(C(F)(F)F)c1)N(Cl)Cl |
| InChI | InChI=1S/C13H18Cl2F3N2/c1-12(2,19(14)15)9-20(3,4)11-7-5-6-10(8-11)13(16,17)18/h5-8H,9H2,1-4H3/q+1 |
| InChIKey | IJHLVBKPFOSOPI-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.20 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|