C14H20F3N2OS+ — CID 20568044
tert-butylsulfanylmethyl-carbamoyl-methyl-[3-(trifluoromethyl)phenyl]azanium (PubChem CID 20568044) has the molecular formula C14H20F3N2OS+ and a molecular weight of 321.39 g/mol. Its IUPAC name is tert-butylsulfanylmethyl-carbamoyl-methyl-[3-(trifluoromethyl)phenyl]azanium.
| Compound Name | tert-butylsulfanylmethyl-carbamoyl-methyl-[3-(trifluoromethyl)phenyl]azanium |
|---|---|
| PubChem CID | 20568044 |
| Molecular Formula | C14H20F3N2OS+ |
| Molecular Weight | 321.39 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | tert-butylsulfanylmethyl-carbamoyl-methyl-[3-(trifluoromethyl)phenyl]azanium |
| SMILES | CC(C)(C)SC[N+](C)(C(N)=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H19F3N2OS/c1-13(2,3)21-9-19(4,12(18)20)11-7-5-6-10(8-11)14(15,16)17/h5-8H,9H2,1-4H3,(H-,18,20)/p+1 |
| InChIKey | LOYXSEVYRCBLKK-UHFFFAOYSA-O |
| XLogP | 4.21 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.39 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|