C14H20Cl2F3N2+ — CID 46200860
[3-(dichloroamino)-3-methylbutyl]-dimethyl-[3-(trifluoromethyl)phenyl]azanium (PubChem CID 46200860) has the molecular formula C14H20Cl2F3N2+ and a molecular weight of 344.23 g/mol. Its IUPAC name is [3-(dichloroamino)-3-methylbutyl]-dimethyl-[3-(trifluoromethyl)phenyl]azanium.
| Compound Name | [3-(dichloroamino)-3-methylbutyl]-dimethyl-[3-(trifluoromethyl)phenyl]azanium |
|---|---|
| PubChem CID | 46200860 |
| Molecular Formula | C14H20Cl2F3N2+ |
| Molecular Weight | 344.23 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | [3-(dichloroamino)-3-methylbutyl]-dimethyl-[3-(trifluoromethyl)phenyl]azanium |
| SMILES | CC(C)(CC[N+](C)(C)c1cccc(C(F)(F)F)c1)N(Cl)Cl |
| InChI | InChI=1S/C14H20Cl2F3N2/c1-13(2,20(15)16)8-9-21(3,4)12-7-5-6-11(10-12)14(17,18)19/h5-7,10H,8-9H2,1-4H3/q+1 |
| InChIKey | ANKWWGLKWHMTLQ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.23 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|