C16H20F3N2O4+ — CID 91358601
(2-acetyl-3-methylbutanoyl)-amino-(carboxymethyl)-[3-(trifluoromethyl)phenyl]azanium (PubChem CID 91358601) has the molecular formula C16H20F3N2O4+ and a molecular weight of 361.34 g/mol. Its IUPAC name is (2-acetyl-3-methylbutanoyl)-amino-(carboxymethyl)-[3-(trifluoromethyl)phenyl]azanium.
| Compound Name | (2-acetyl-3-methylbutanoyl)-amino-(carboxymethyl)-[3-(trifluoromethyl)phenyl]azanium |
|---|---|
| PubChem CID | 91358601 |
| Molecular Formula | C16H20F3N2O4+ |
| Molecular Weight | 361.34 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | (2-acetyl-3-methylbutanoyl)-amino-(carboxymethyl)-[3-(trifluoromethyl)phenyl]azanium |
| SMILES | CC(=O)C(C(=O)[N+](N)(CC(=O)O)c1cccc(C(F)(F)F)c1)C(C)C |
| InChI | InChI=1S/C16H19F3N2O4/c1-9(2)14(10(3)22)15(25)21(20,8-13(23)24)12-6-4-5-11(7-12)16(17,18)19/h4-7,9,14H,8,20H2,1-3H3/p+1 |
| InChIKey | DTVKHVIQJCUIHI-UHFFFAOYSA-O |
| XLogP | 2.36 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.34 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|