C24H26N2O4 — CID 46201360
[(3aR,4S,5S,7aR)-2-(acetyloxymethyl)-5,6-dicyano-7-methyl-4-phenyl-1,3,3a,4,5,7a-hexahydroinden-2-yl]methyl acetate (PubChem CID 46201360) has the molecular formula C24H26N2O4 and a molecular weight of 406.48 g/mol. Its IUPAC name is [(3aR,4S,5S,7aR)-2-(acetyloxymethyl)-5,6-dicyano-7-methyl-4-phenyl-1,3,3a,4,5,7a-hexahydroinden-2-yl]methyl acetate.
| Compound Name | [(3aR,4S,5S,7aR)-2-(acetyloxymethyl)-5,6-dicyano-7-methyl-4-phenyl-1,3,3a,4,5,7a-hexahydroinden-2-yl]methyl acetate |
|---|---|
| PubChem CID | 46201360 |
| Molecular Formula | C24H26N2O4 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | [(3aR,4S,5S,7aR)-2-(acetyloxymethyl)-5,6-dicyano-7-methyl-4-phenyl-1,3,3a,4,5,7a-hexahydroinden-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1(COC(C)=O)C[C@H]2[C@H](c3ccccc3)[C@H](C#N)C(C#N)=C(C)[C@@H]2C1 |
| InChI | InChI=1S/C24H26N2O4/c1-15-19-9-24(13-29-16(2)27,14-30-17(3)28)10-20(19)23(18-7-5-4-6-8-18)22(12-26)21(15)11-25/h4-8,19-20,22-23H,9-10,13-14H2,1-3H3/t19-,20+,22+,23-/m0/s1 |
| InChIKey | MLVQNODZDVKTEB-JVSAHFFESA-N |
| XLogP | 3.90 |
| TPSA | 100.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |