C23H21NO2 — CID 177406248
(2Z,4R)-2-(3-oxopentan-2-ylidene)-4,6-diphenyl-3,4-dihydropyran-5-carbonitrile (PubChem CID 177406248) has the molecular formula C23H21NO2 and a molecular weight of 343.43 g/mol. Its IUPAC name is (2Z,4R)-2-(3-oxopentan-2-ylidene)-4,6-diphenyl-3,4-dihydropyran-5-carbonitrile.
| Compound Name | (2Z,4R)-2-(3-oxopentan-2-ylidene)-4,6-diphenyl-3,4-dihydropyran-5-carbonitrile |
|---|---|
| PubChem CID | 177406248 |
| Molecular Formula | C23H21NO2 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | (2Z,4R)-2-(3-oxopentan-2-ylidene)-4,6-diphenyl-3,4-dihydropyran-5-carbonitrile |
| SMILES | CCC(=O)/C(C)=C1/C[C@H](c2ccccc2)C(C#N)=C(c2ccccc2)O1 |
| InChI | InChI=1S/C23H21NO2/c1-3-21(25)16(2)22-14-19(17-10-6-4-7-11-17)20(15-24)23(26-22)18-12-8-5-9-13-18/h4-13,19H,3,14H2,1-2H3/b22-16-/t19-/m1/s1 |
| InChIKey | AAPIKAOHVDPYNX-OSEFQUDUSA-N |
| XLogP | 5.38 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|