C16H15Cl2NO5S — CID 46204746
2-[(2-methoxynaphthalen-1-yl)sulfonylamino]pentanedioyl dichloride (PubChem CID 46204746) has the molecular formula C16H15Cl2NO5S and a molecular weight of 404.27 g/mol. Its IUPAC name is 2-[(2-methoxynaphthalen-1-yl)sulfonylamino]pentanedioyl dichloride.
| Compound Name | 2-[(2-methoxynaphthalen-1-yl)sulfonylamino]pentanedioyl dichloride |
|---|---|
| PubChem CID | 46204746 |
| Molecular Formula | C16H15Cl2NO5S |
| Molecular Weight | 404.27 g/mol |
| Exact Mass | 403.00 |
| IUPAC Name | 2-[(2-methoxynaphthalen-1-yl)sulfonylamino]pentanedioyl dichloride |
| SMILES | COc1ccc2ccccc2c1S(=O)(=O)NC(CCC(=O)Cl)C(=O)Cl |
| InChI | InChI=1S/C16H15Cl2NO5S/c1-24-13-8-6-10-4-2-3-5-11(10)15(13)25(22,23)19-12(16(18)21)7-9-14(17)20/h2-6,8,12,19H,7,9H2,1H3 |
| InChIKey | MEDMVFHUMHFXAM-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.27 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|