C15H11F6NO3S2 — CID 46206250
phenyl-pyridin-2-yl-[(E)-3,3,3-trifluoroprop-1-enyl]sulfanium;trifluoromethanesulfonate (PubChem CID 46206250) has the molecular formula C15H11F6NO3S2 and a molecular weight of 431.38 g/mol. Its IUPAC name is phenyl-pyridin-2-yl-[(E)-3,3,3-trifluoroprop-1-enyl]sulfanium;trifluoromethanesulfonate.
| Compound Name | phenyl-pyridin-2-yl-[(E)-3,3,3-trifluoroprop-1-enyl]sulfanium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 46206250 |
| Molecular Formula | C15H11F6NO3S2 |
| Molecular Weight | 431.38 g/mol |
| Exact Mass | 431.01 |
| IUPAC Name | phenyl-pyridin-2-yl-[(E)-3,3,3-trifluoroprop-1-enyl]sulfanium;trifluoromethanesulfonate |
| SMILES | FC(F)(F)/C=C/[S+](c1ccccc1)c1ccccn1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C14H11F3NS.CHF3O3S/c15-14(16,17)9-11-19(12-6-2-1-3-7-12)13-8-4-5-10-18-13;2-1(3,4)8(5,6)7/h1-11H;(H,5,6,7)/q+1;/p-1/b11-9+; |
| InChIKey | GQZXWVCKGQAHTQ-LBEJWNQZSA-M |
| XLogP | 4.25 |
| TPSA | 70.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.38 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|