C27H20N4O2 — CID 46209310
3-imidazo[1,2-a]pyridin-3-yl-6-[(4-methoxyphenyl)methyl]benzo[h]quinazolin-4-one (PubChem CID 46209310) has the molecular formula C27H20N4O2 and a molecular weight of 432.48 g/mol. Its IUPAC name is 3-imidazo[1,2-a]pyridin-3-yl-6-[(4-methoxyphenyl)methyl]benzo[h]quinazolin-4-one.
| Compound Name | 3-imidazo[1,2-a]pyridin-3-yl-6-[(4-methoxyphenyl)methyl]benzo[h]quinazolin-4-one |
|---|---|
| PubChem CID | 46209310 |
| Molecular Formula | C27H20N4O2 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | 3-imidazo[1,2-a]pyridin-3-yl-6-[(4-methoxyphenyl)methyl]benzo[h]quinazolin-4-one |
| SMILES | COc1ccc(Cc2cc3c(=O)n(-c4cnc5ccccn45)cnc3c3ccccc23)cc1 |
| InChI | InChI=1S/C27H20N4O2/c1-33-20-11-9-18(10-12-20)14-19-15-23-26(22-7-3-2-6-21(19)22)29-17-31(27(23)32)25-16-28-24-8-4-5-13-30(24)25/h2-13,15-17H,14H2,1H3 |
| InChIKey | SELQGQJMHIKUEJ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|