C10H16N2O4S3 — CID 46211831
(4S,6S)-3,5,5-trideuterio-4-(ethylamino)-7,7-dioxo-6-(trideuteriomethyl)-4,6-dihydrothieno[2,3-b]thiopyran-2-sulfonamide (PubChem CID 46211831) has the molecular formula C10H16N2O4S3 and a molecular weight of 330.49 g/mol. Its IUPAC name is (4S,6S)-3,5,5-trideuterio-4-(ethylamino)-7,7-dioxo-6-(trideuteriomethyl)-4,6-dihydrothieno[2,3-b]thiopyran-2-sulfonamide.
| Compound Name | (4S,6S)-3,5,5-trideuterio-4-(ethylamino)-7,7-dioxo-6-(trideuteriomethyl)-4,6-dihydrothieno[2,3-b]thiopyran-2-sulfonamide |
|---|---|
| PubChem CID | 46211831 |
| Molecular Formula | C10H16N2O4S3 |
| Molecular Weight | 330.49 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | (4S,6S)-3,5,5-trideuterio-4-(ethylamino)-7,7-dioxo-6-(trideuteriomethyl)-4,6-dihydrothieno[2,3-b]thiopyran-2-sulfonamide |
| SMILES | [2H]c1c(S(N)(=O)=O)sc2c1[C@@H](NCC)C([2H])([2H])[C@H](C([2H])([2H])[2H])S2(=O)=O |
| InChI | InChI=1S/C10H16N2O4S3/c1-3-12-8-4-6(2)18(13,14)10-7(8)5-9(17-10)19(11,15)16/h5-6,8,12H,3-4H2,1-2H3,(H2,11,15,16)/t6-,8-/m0/s1/i2D3,4D2,5D |
| InChIKey | IAVUPMFITXYVAF-XUFLDWEHSA-N |
| XLogP | 0.61 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.49 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |