C17H12BrCl3N2O2 — CID 46218126
N-(4-bromophenyl)-5-methyl-3-(2,3,6-trichlorophenyl)-4,5-dihydro-1,2-oxazole-4-carboxamide (PubChem CID 46218126) has the molecular formula C17H12BrCl3N2O2 and a molecular weight of 462.56 g/mol. Its IUPAC name is N-(4-bromophenyl)-5-methyl-3-(2,3,6-trichlorophenyl)-4,5-dihydro-1,2-oxazole-4-carboxamide.
| Compound Name | N-(4-bromophenyl)-5-methyl-3-(2,3,6-trichlorophenyl)-4,5-dihydro-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 46218126 |
| Molecular Formula | C17H12BrCl3N2O2 |
| Molecular Weight | 462.56 g/mol |
| Exact Mass | 459.91 |
| IUPAC Name | N-(4-bromophenyl)-5-methyl-3-(2,3,6-trichlorophenyl)-4,5-dihydro-1,2-oxazole-4-carboxamide |
| SMILES | CC1ON=C(c2c(Cl)ccc(Cl)c2Cl)C1C(=O)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C17H12BrCl3N2O2/c1-8-13(17(24)22-10-4-2-9(18)3-5-10)16(23-25-8)14-11(19)6-7-12(20)15(14)21/h2-8,13H,1H3,(H,22,24) |
| InChIKey | CQUJUVKUOXLCJL-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.56 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|