C21H25N3 — CID 46220307
1,1,3,3,4,4-hexadeuterio-5-[2,2-dideuterio-2-[6-(trideuteriomethyl)-3-pyridinyl]ethyl]-8-methyl-2-(trideuteriomethyl)pyrido[4,3-b]indole (PubChem CID 46220307) has the molecular formula C21H25N3 and a molecular weight of 333.54 g/mol. Its IUPAC name is 1,1,3,3,4,4-hexadeuterio-5-[2,2-dideuterio-2-[6-(trideuteriomethyl)-3-pyridinyl]ethyl]-8-methyl-2-(trideuteriomethyl)pyrido[4,3-b]indole.
| Compound Name | 1,1,3,3,4,4-hexadeuterio-5-[2,2-dideuterio-2-[6-(trideuteriomethyl)-3-pyridinyl]ethyl]-8-methyl-2-(trideuteriomethyl)pyrido[4,3-b]indole |
|---|---|
| PubChem CID | 46220307 |
| Molecular Formula | C21H25N3 |
| Molecular Weight | 333.54 g/mol |
| Exact Mass | 333.29 |
| IUPAC Name | 1,1,3,3,4,4-hexadeuterio-5-[2,2-dideuterio-2-[6-(trideuteriomethyl)-3-pyridinyl]ethyl]-8-methyl-2-(trideuteriomethyl)pyrido[4,3-b]indole |
| SMILES | [2H]C([2H])([2H])c1ccc(C([2H])([2H])Cn2c3c(c4cc(C)ccc42)C([2H])([2H])N(C([2H])([2H])[2H])C([2H])([2H])C3([2H])[2H])cn1 |
| InChI | InChI=1S/C21H25N3/c1-15-4-7-20-18(12-15)19-14-23(3)10-9-21(19)24(20)11-8-17-6-5-16(2)22-13-17/h4-7,12-13H,8-11,14H2,1-3H3/i2D3,3D3,8D2,9D2,10D2,14D2 |
| InChIKey | JNODQFNWMXFMEV-KWTSOCIHSA-N |
| XLogP | 3.88 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.54 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|