C37H31NO3 — CID 46223519
ethyl 4-[1-(1-benzylindol-3-yl)-3-(1-formylcyclopropyl)-3-phenylpropa-1,2-dienyl]benzoate (PubChem CID 46223519) has the molecular formula C37H31NO3 and a molecular weight of 537.66 g/mol. Its IUPAC name is ethyl 4-[1-(1-benzylindol-3-yl)-3-(1-formylcyclopropyl)-3-phenylpropa-1,2-dienyl]benzoate.
| Compound Name | ethyl 4-[1-(1-benzylindol-3-yl)-3-(1-formylcyclopropyl)-3-phenylpropa-1,2-dienyl]benzoate |
|---|---|
| PubChem CID | 46223519 |
| Molecular Formula | C37H31NO3 |
| Molecular Weight | 537.66 g/mol |
| Exact Mass | 537.23 |
| IUPAC Name | ethyl 4-[1-(1-benzylindol-3-yl)-3-(1-formylcyclopropyl)-3-phenylpropa-1,2-dienyl]benzoate |
| SMILES | CCOC(=O)c1ccc(C(=C=C(c2ccccc2)C2(C=O)CC2)c2cn(Cc3ccccc3)c3ccccc23)cc1 |
| InChI | InChI=1S/C37H31NO3/c1-2-41-36(40)30-19-17-28(18-20-30)32(23-34(37(26-39)21-22-37)29-13-7-4-8-14-29)33-25-38(24-27-11-5-3-6-12-27)35-16-10-9-15-31(33)35/h3-20,25-26H,2,21-22,24H2,1H3 |
| InChIKey | RMVDODKRYIXFEI-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.66 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|